C17H19N3OS — CID 2499128
(5S)-5-methyl-N'-(1-pyridin-4-ylethenyl)-4,5,6,7-tetrahydro-1-benzothiophene-2-carbohydrazide (PubChem CID 2499128) has the molecular formula C17H19N3OS and a molecular weight of 313.43 g/mol. Its IUPAC name is (5S)-5-methyl-N'-(1-pyridin-4-ylethenyl)-4,5,6,7-tetrahydro-1-benzothiophene-2-carbohydrazide.
| Compound Name | (5S)-5-methyl-N'-(1-pyridin-4-ylethenyl)-4,5,6,7-tetrahydro-1-benzothiophene-2-carbohydrazide |
|---|---|
| PubChem CID | 2499128 |
| Molecular Formula | C17H19N3OS |
| Molecular Weight | 313.43 g/mol |
| Exact Mass | 313.12 |
| IUPAC Name | (5S)-5-methyl-N'-(1-pyridin-4-ylethenyl)-4,5,6,7-tetrahydro-1-benzothiophene-2-carbohydrazide |
| SMILES | C=C(NNC(=O)c1cc2c(s1)CC[C@H](C)C2)c1ccncc1 |
| InChI | InChI=1S/C17H19N3OS/c1-11-3-4-15-14(9-11)10-16(22-15)17(21)20-19-12(2)13-5-7-18-8-6-13/h5-8,10-11,19H,2-4,9H2,1H3,(H,20,21)/t11-/m0/s1 |
| InChIKey | BEGZJXCWIDERFE-NSHDSACASA-N |
| XLogP | 3.17 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.43 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|