C17H16ClFN2O2S — CID 9090723
(5R)-N'-(5-chloro-2-fluorobenzoyl)-5-methyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carbohydrazide (PubChem CID 9090723) has the molecular formula C17H16ClFN2O2S and a molecular weight of 366.85 g/mol. Its IUPAC name is (5R)-N'-(5-chloro-2-fluorobenzoyl)-5-methyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carbohydrazide.
| Compound Name | (5R)-N'-(5-chloro-2-fluorobenzoyl)-5-methyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carbohydrazide |
|---|---|
| PubChem CID | 9090723 |
| Molecular Formula | C17H16ClFN2O2S |
| Molecular Weight | 366.85 g/mol |
| Exact Mass | 366.06 |
| IUPAC Name | (5R)-N'-(5-chloro-2-fluorobenzoyl)-5-methyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carbohydrazide |
| SMILES | C[C@@H]1CCc2sc(C(=O)NNC(=O)c3cc(Cl)ccc3F)cc2C1 |
| InChI | InChI=1S/C17H16ClFN2O2S/c1-9-2-5-14-10(6-9)7-15(24-14)17(23)21-20-16(22)12-8-11(18)3-4-13(12)19/h3-4,7-9H,2,5-6H2,1H3,(H,20,22)(H,21,23)/t9-/m1/s1 |
| InChIKey | URZZOAHOLDOICN-SECBINFHSA-N |
| XLogP | 3.74 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.85 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|