C17H16F2N2OS — CID 7430663
(5S)-N-[(Z)-(2,4-difluorophenyl)methylideneamino]-5-methyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxamide (PubChem CID 7430663) has the molecular formula C17H16F2N2OS and a molecular weight of 334.39 g/mol. Its IUPAC name is (5S)-N-[(Z)-(2,4-difluorophenyl)methylideneamino]-5-methyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxamide.
| Compound Name | (5S)-N-[(Z)-(2,4-difluorophenyl)methylideneamino]-5-methyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 7430663 |
| Molecular Formula | C17H16F2N2OS |
| Molecular Weight | 334.39 g/mol |
| Exact Mass | 334.10 |
| IUPAC Name | (5S)-N-[(Z)-(2,4-difluorophenyl)methylideneamino]-5-methyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxamide |
| SMILES | C[C@H]1CCc2sc(C(=O)N/N=C\c3ccc(F)cc3F)cc2C1 |
| InChI | InChI=1S/C17H16F2N2OS/c1-10-2-5-15-12(6-10)7-16(23-15)17(22)21-20-9-11-3-4-13(18)8-14(11)19/h3-4,7-10H,2,5-6H2,1H3,(H,21,22)/b20-9-/t10-/m0/s1 |
| InChIKey | JCVFXYNVSYYDTR-ZFKRWFGPSA-N |
| XLogP | 3.91 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.39 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|