C17H18N2O3S — CID 135852495
(5S)-N-[(E)-(2,3-dihydroxyphenyl)methylideneamino]-5-methyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxamide (PubChem CID 135852495) has the molecular formula C17H18N2O3S and a molecular weight of 330.41 g/mol. Its IUPAC name is (5S)-N-[(E)-(2,3-dihydroxyphenyl)methylideneamino]-5-methyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxamide.
| Compound Name | (5S)-N-[(E)-(2,3-dihydroxyphenyl)methylideneamino]-5-methyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 135852495 |
| Molecular Formula | C17H18N2O3S |
| Molecular Weight | 330.41 g/mol |
| Exact Mass | 330.10 |
| IUPAC Name | (5S)-N-[(E)-(2,3-dihydroxyphenyl)methylideneamino]-5-methyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxamide |
| SMILES | C[C@H]1CCc2sc(C(=O)N/N=C/c3cccc(O)c3O)cc2C1 |
| InChI | InChI=1S/C17H18N2O3S/c1-10-5-6-14-12(7-10)8-15(23-14)17(22)19-18-9-11-3-2-4-13(20)16(11)21/h2-4,8-10,20-21H,5-7H2,1H3,(H,19,22)/b18-9+/t10-/m0/s1 |
| InChIKey | PZXDJZABXDFMHL-NTOSSWPYSA-N |
| XLogP | 3.05 |
| TPSA | 81.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.41 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|