C21H20N2OS — CID 7430487
(5R)-5-methyl-N-[(Z)-naphthalen-1-ylmethylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxamide (PubChem CID 7430487) has the molecular formula C21H20N2OS and a molecular weight of 348.47 g/mol. Its IUPAC name is (5R)-5-methyl-N-[(Z)-naphthalen-1-ylmethylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxamide.
| Compound Name | (5R)-5-methyl-N-[(Z)-naphthalen-1-ylmethylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 7430487 |
| Molecular Formula | C21H20N2OS |
| Molecular Weight | 348.47 g/mol |
| Exact Mass | 348.13 |
| IUPAC Name | (5R)-5-methyl-N-[(Z)-naphthalen-1-ylmethylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxamide |
| SMILES | C[C@@H]1CCc2sc(C(=O)N/N=C\c3cccc4ccccc34)cc2C1 |
| InChI | InChI=1S/C21H20N2OS/c1-14-9-10-19-17(11-14)12-20(25-19)21(24)23-22-13-16-7-4-6-15-5-2-3-8-18(15)16/h2-8,12-14H,9-11H2,1H3,(H,23,24)/b22-13-/t14-/m1/s1 |
| InChIKey | XODKHYOODLNCLZ-BXSODOALSA-N |
| XLogP | 4.79 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.47 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|