C20H20N4OS — CID 8981405
(5S)-5-methyl-N-[(Z)-(1-phenylpyrazol-4-yl)methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxamide (PubChem CID 8981405) has the molecular formula C20H20N4OS and a molecular weight of 364.47 g/mol. Its IUPAC name is (5S)-5-methyl-N-[(Z)-(1-phenylpyrazol-4-yl)methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxamide.
| Compound Name | (5S)-5-methyl-N-[(Z)-(1-phenylpyrazol-4-yl)methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 8981405 |
| Molecular Formula | C20H20N4OS |
| Molecular Weight | 364.47 g/mol |
| Exact Mass | 364.14 |
| IUPAC Name | (5S)-5-methyl-N-[(Z)-(1-phenylpyrazol-4-yl)methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxamide |
| SMILES | C[C@H]1CCc2sc(C(=O)N/N=C\c3cnn(-c4ccccc4)c3)cc2C1 |
| InChI | InChI=1S/C20H20N4OS/c1-14-7-8-18-16(9-14)10-19(26-18)20(25)23-21-11-15-12-22-24(13-15)17-5-3-2-4-6-17/h2-6,10-14H,7-9H2,1H3,(H,23,25)/b21-11-/t14-/m0/s1 |
| InChIKey | ZWBKCWPPJSORAV-LRXPYSHVSA-N |
| XLogP | 3.82 |
| TPSA | 59.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.47 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|