C21H21ClN4OS — CID 7430897
(5S)-N-[(Z)-(5-chloro-3-methyl-1-phenylpyrazol-4-yl)methylideneamino]-5-methyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxamide (PubChem CID 7430897) has the molecular formula C21H21ClN4OS and a molecular weight of 412.95 g/mol. Its IUPAC name is (5S)-N-[(Z)-(5-chloro-3-methyl-1-phenylpyrazol-4-yl)methylideneamino]-5-methyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxamide.
| Compound Name | (5S)-N-[(Z)-(5-chloro-3-methyl-1-phenylpyrazol-4-yl)methylideneamino]-5-methyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 7430897 |
| Molecular Formula | C21H21ClN4OS |
| Molecular Weight | 412.95 g/mol |
| Exact Mass | 412.11 |
| IUPAC Name | (5S)-N-[(Z)-(5-chloro-3-methyl-1-phenylpyrazol-4-yl)methylideneamino]-5-methyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxamide |
| SMILES | Cc1nn(-c2ccccc2)c(Cl)c1/C=N\NC(=O)c1cc2c(s1)CC[C@H](C)C2 |
| InChI | InChI=1S/C21H21ClN4OS/c1-13-8-9-18-15(10-13)11-19(28-18)21(27)24-23-12-17-14(2)25-26(20(17)22)16-6-4-3-5-7-16/h3-7,11-13H,8-10H2,1-2H3,(H,24,27)/b23-12-/t13-/m0/s1 |
| InChIKey | AGTWNNZCUPQZTH-JFVYAULHSA-N |
| XLogP | 4.78 |
| TPSA | 59.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.95 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|