C21H23N5O2S — CID 55506674
1-[(5-methyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carbonyl)amino]-3-[(1-phenylpyrazol-4-yl)methyl]urea (PubChem CID 55506674) has the molecular formula C21H23N5O2S and a molecular weight of 409.52 g/mol. Its IUPAC name is 1-[(5-methyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carbonyl)amino]-3-[(1-phenylpyrazol-4-yl)methyl]urea.
| Compound Name | 1-[(5-methyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carbonyl)amino]-3-[(1-phenylpyrazol-4-yl)methyl]urea |
|---|---|
| PubChem CID | 55506674 |
| Molecular Formula | C21H23N5O2S |
| Molecular Weight | 409.52 g/mol |
| Exact Mass | 409.16 |
| IUPAC Name | 1-[(5-methyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carbonyl)amino]-3-[(1-phenylpyrazol-4-yl)methyl]urea |
| SMILES | CC1CCc2sc(C(=O)NNC(=O)NCc3cnn(-c4ccccc4)c3)cc2C1 |
| InChI | InChI=1S/C21H23N5O2S/c1-14-7-8-18-16(9-14)10-19(29-18)20(27)24-25-21(28)22-11-15-12-23-26(13-15)17-5-3-2-4-6-17/h2-6,10,12-14H,7-9,11H2,1H3,(H,24,27)(H2,22,25,28) |
| InChIKey | VOBPRHWMCQPSKH-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 88.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.52 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|