C20H20N4O2S — CID 40792333
N'-[(5R)-5-methyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carbonyl]-5-phenyl-1H-pyrazole-4-carbohydrazide (PubChem CID 40792333) has the molecular formula C20H20N4O2S and a molecular weight of 380.47 g/mol. Its IUPAC name is N'-[(5R)-5-methyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carbonyl]-5-phenyl-1H-pyrazole-4-carbohydrazide.
| Compound Name | N'-[(5R)-5-methyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carbonyl]-5-phenyl-1H-pyrazole-4-carbohydrazide |
|---|---|
| PubChem CID | 40792333 |
| Molecular Formula | C20H20N4O2S |
| Molecular Weight | 380.47 g/mol |
| Exact Mass | 380.13 |
| IUPAC Name | N'-[(5R)-5-methyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carbonyl]-5-phenyl-1H-pyrazole-4-carbohydrazide |
| SMILES | C[C@@H]1CCc2sc(C(=O)NNC(=O)c3cn[nH]c3-c3ccccc3)cc2C1 |
| InChI | InChI=1S/C20H20N4O2S/c1-12-7-8-16-14(9-12)10-17(27-16)20(26)24-23-19(25)15-11-21-22-18(15)13-5-3-2-4-6-13/h2-6,10-12H,7-9H2,1H3,(H,21,22)(H,23,25)(H,24,26)/t12-/m1/s1 |
| InChIKey | REDAGKGITIMJDP-GFCCVEGCSA-N |
| XLogP | 3.34 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.47 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|