C25H24FN3O3S — CID 55689775
2-fluoro-N-[2-methyl-5-[[(5-methyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carbonyl)amino]carbamoyl]phenyl]benzamide (PubChem CID 55689775) has the molecular formula C25H24FN3O3S and a molecular weight of 465.55 g/mol. Its IUPAC name is 2-fluoro-N-[2-methyl-5-[[(5-methyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carbonyl)amino]carbamoyl]phenyl]benzamide.
| Compound Name | 2-fluoro-N-[2-methyl-5-[[(5-methyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carbonyl)amino]carbamoyl]phenyl]benzamide |
|---|---|
| PubChem CID | 55689775 |
| Molecular Formula | C25H24FN3O3S |
| Molecular Weight | 465.55 g/mol |
| Exact Mass | 465.15 |
| IUPAC Name | 2-fluoro-N-[2-methyl-5-[[(5-methyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carbonyl)amino]carbamoyl]phenyl]benzamide |
| SMILES | Cc1ccc(C(=O)NNC(=O)c2cc3c(s2)CCC(C)C3)cc1NC(=O)c1ccccc1F |
| InChI | InChI=1S/C25H24FN3O3S/c1-14-7-10-21-17(11-14)13-22(33-21)25(32)29-28-23(30)16-9-8-15(2)20(12-16)27-24(31)18-5-3-4-6-19(18)26/h3-6,8-9,12-14H,7,10-11H2,1-2H3,(H,27,31)(H,28,30)(H,29,32) |
| InChIKey | FJWKYYRGNYQIBW-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.55 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|