C10H11ClOS — CID 6485363
5-methyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carbonyl chloride (PubChem CID 6485363) has the molecular formula C10H11ClOS and a molecular weight of 214.72 g/mol. Its IUPAC name is 5-methyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carbonyl chloride.
| Compound Name | 5-methyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carbonyl chloride |
|---|---|
| PubChem CID | 6485363 |
| Molecular Formula | C10H11ClOS |
| Molecular Weight | 214.72 g/mol |
| Exact Mass | 214.02 |
| IUPAC Name | 5-methyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carbonyl chloride |
| SMILES | CC1CCc2sc(C(=O)Cl)cc2C1 |
| InChI | InChI=1S/C10H11ClOS/c1-6-2-3-8-7(4-6)5-9(13-8)10(11)12/h5-6H,2-4H2,1H3 |
| InChIKey | RAQMTDUDQJTUHH-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.72 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|