C20H26N2OS — CID 7430681
(5R)-N-(2-adamantylideneamino)-5-methyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxamide (PubChem CID 7430681) has the molecular formula C20H26N2OS and a molecular weight of 342.51 g/mol. Its IUPAC name is (5R)-N-(2-adamantylideneamino)-5-methyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxamide.
| Compound Name | (5R)-N-(2-adamantylideneamino)-5-methyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 7430681 |
| Molecular Formula | C20H26N2OS |
| Molecular Weight | 342.51 g/mol |
| Exact Mass | 342.18 |
| IUPAC Name | (5R)-N-(2-adamantylideneamino)-5-methyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxamide |
| SMILES | C[C@@H]1CCc2sc(C(=O)NN=C3C4CC5CC(C4)CC3C5)cc2C1 |
| InChI | InChI=1S/C20H26N2OS/c1-11-2-3-17-14(4-11)10-18(24-17)20(23)22-21-19-15-6-12-5-13(8-15)9-16(19)7-12/h10-13,15-16H,2-9H2,1H3,(H,22,23)/b21-19-/t11-,12?,13?,15?,16?/m1/s1 |
| InChIKey | OMQWNVFPLOGCMV-DOTMQQHMSA-N |
| XLogP | 4.41 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.51 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|