C19H26N2OS — CID 7430877
(5S)-5-methyl-N-[(Z)-(3,5,5-trimethylcyclohex-2-en-1-ylidene)amino]-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxamide (PubChem CID 7430877) has the molecular formula C19H26N2OS and a molecular weight of 330.50 g/mol. Its IUPAC name is (5S)-5-methyl-N-[(Z)-(3,5,5-trimethylcyclohex-2-en-1-ylidene)amino]-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxamide.
| Compound Name | (5S)-5-methyl-N-[(Z)-(3,5,5-trimethylcyclohex-2-en-1-ylidene)amino]-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 7430877 |
| Molecular Formula | C19H26N2OS |
| Molecular Weight | 330.50 g/mol |
| Exact Mass | 330.18 |
| IUPAC Name | (5S)-5-methyl-N-[(Z)-(3,5,5-trimethylcyclohex-2-en-1-ylidene)amino]-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxamide |
| SMILES | CC1=C/C(=N\NC(=O)c2cc3c(s2)CC[C@H](C)C3)CC(C)(C)C1 |
| InChI | InChI=1S/C19H26N2OS/c1-12-5-6-16-14(7-12)9-17(23-16)18(22)21-20-15-8-13(2)10-19(3,4)11-15/h8-9,12H,5-7,10-11H2,1-4H3,(H,21,22)/b20-15+/t12-/m0/s1 |
| InChIKey | JHSGHFFQILLKTL-PQXWDWFGSA-N |
| XLogP | 4.72 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.50 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|