C14H16N4O2S2 — CID 9090697
4-methyl-N'-[(5S)-5-methyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carbonyl]thiadiazole-5-carbohydrazide (PubChem CID 9090697) has the molecular formula C14H16N4O2S2 and a molecular weight of 336.44 g/mol. Its IUPAC name is 4-methyl-N'-[(5S)-5-methyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carbonyl]thiadiazole-5-carbohydrazide.
| Compound Name | 4-methyl-N'-[(5S)-5-methyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carbonyl]thiadiazole-5-carbohydrazide |
|---|---|
| PubChem CID | 9090697 |
| Molecular Formula | C14H16N4O2S2 |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.07 |
| IUPAC Name | 4-methyl-N'-[(5S)-5-methyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carbonyl]thiadiazole-5-carbohydrazide |
| SMILES | Cc1nnsc1C(=O)NNC(=O)c1cc2c(s1)CC[C@H](C)C2 |
| InChI | InChI=1S/C14H16N4O2S2/c1-7-3-4-10-9(5-7)6-11(21-10)13(19)16-17-14(20)12-8(2)15-18-22-12/h6-7H,3-5H2,1-2H3,(H,16,19)(H,17,20)/t7-/m0/s1 |
| InChIKey | HZENJMZBDDKLRI-ZETCQYMHSA-N |
| XLogP | 2.11 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|