C17H22N4O2S2 — CID 9089543
N'-[(5S)-5-tert-butyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carbonyl]-4-methylthiadiazole-5-carbohydrazide (PubChem CID 9089543) has the molecular formula C17H22N4O2S2 and a molecular weight of 378.52 g/mol. Its IUPAC name is N'-[(5S)-5-tert-butyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carbonyl]-4-methylthiadiazole-5-carbohydrazide.
| Compound Name | N'-[(5S)-5-tert-butyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carbonyl]-4-methylthiadiazole-5-carbohydrazide |
|---|---|
| PubChem CID | 9089543 |
| Molecular Formula | C17H22N4O2S2 |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.12 |
| IUPAC Name | N'-[(5S)-5-tert-butyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carbonyl]-4-methylthiadiazole-5-carbohydrazide |
| SMILES | Cc1nnsc1C(=O)NNC(=O)c1cc2c(s1)CC[C@H](C(C)(C)C)C2 |
| InChI | InChI=1S/C17H22N4O2S2/c1-9-14(25-21-18-9)16(23)20-19-15(22)13-8-10-7-11(17(2,3)4)5-6-12(10)24-13/h8,11H,5-7H2,1-4H3,(H,19,22)(H,20,23)/t11-/m0/s1 |
| InChIKey | WRUUDEZTTQBBOL-NSHDSACASA-N |
| XLogP | 3.13 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|