C18H24N4O2S — CID 9426782
N'-[(5R)-5-tert-butyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carbonyl]-1-methylpyrazole-4-carbohydrazide (PubChem CID 9426782) has the molecular formula C18H24N4O2S and a molecular weight of 360.48 g/mol. Its IUPAC name is N'-[(5R)-5-tert-butyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carbonyl]-1-methylpyrazole-4-carbohydrazide.
| Compound Name | N'-[(5R)-5-tert-butyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carbonyl]-1-methylpyrazole-4-carbohydrazide |
|---|---|
| PubChem CID | 9426782 |
| Molecular Formula | C18H24N4O2S |
| Molecular Weight | 360.48 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | N'-[(5R)-5-tert-butyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carbonyl]-1-methylpyrazole-4-carbohydrazide |
| SMILES | Cn1cc(C(=O)NNC(=O)c2cc3c(s2)CC[C@@H](C(C)(C)C)C3)cn1 |
| InChI | InChI=1S/C18H24N4O2S/c1-18(2,3)13-5-6-14-11(7-13)8-15(25-14)17(24)21-20-16(23)12-9-19-22(4)10-12/h8-10,13H,5-7H2,1-4H3,(H,20,23)(H,21,24)/t13-/m1/s1 |
| InChIKey | DFWBCIVSMMFMKV-CYBMUJFWSA-N |
| XLogP | 2.71 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.48 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|