C19H28N2O4S2 — CID 9426780
(5R)-5-tert-butyl-N'-[2-[(3S)-1,1-dioxothiolan-3-yl]acetyl]-4,5,6,7-tetrahydro-1-benzothiophene-2-carbohydrazide (PubChem CID 9426780) has the molecular formula C19H28N2O4S2 and a molecular weight of 412.58 g/mol. Its IUPAC name is (5R)-5-tert-butyl-N'-[2-[(3S)-1,1-dioxothiolan-3-yl]acetyl]-4,5,6,7-tetrahydro-1-benzothiophene-2-carbohydrazide.
| Compound Name | (5R)-5-tert-butyl-N'-[2-[(3S)-1,1-dioxothiolan-3-yl]acetyl]-4,5,6,7-tetrahydro-1-benzothiophene-2-carbohydrazide |
|---|---|
| PubChem CID | 9426780 |
| Molecular Formula | C19H28N2O4S2 |
| Molecular Weight | 412.58 g/mol |
| Exact Mass | 412.15 |
| IUPAC Name | (5R)-5-tert-butyl-N'-[2-[(3S)-1,1-dioxothiolan-3-yl]acetyl]-4,5,6,7-tetrahydro-1-benzothiophene-2-carbohydrazide |
| SMILES | CC(C)(C)[C@@H]1CCc2sc(C(=O)NNC(=O)C[C@H]3CCS(=O)(=O)C3)cc2C1 |
| InChI | InChI=1S/C19H28N2O4S2/c1-19(2,3)14-4-5-15-13(9-14)10-16(26-15)18(23)21-20-17(22)8-12-6-7-27(24,25)11-12/h10,12,14H,4-9,11H2,1-3H3,(H,20,22)(H,21,23)/t12-,14-/m1/s1 |
| InChIKey | FWXLJEFEFZMJMU-TZMCWYRMSA-N |
| XLogP | 2.48 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.58 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|