C15H20N2O4S2 — CID 9083212
(5R)-N'-[(3R)-1,1-dioxothiolane-3-carbonyl]-5-methyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carbohydrazide (PubChem CID 9083212) has the molecular formula C15H20N2O4S2 and a molecular weight of 356.47 g/mol. Its IUPAC name is (5R)-N'-[(3R)-1,1-dioxothiolane-3-carbonyl]-5-methyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carbohydrazide.
| Compound Name | (5R)-N'-[(3R)-1,1-dioxothiolane-3-carbonyl]-5-methyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carbohydrazide |
|---|---|
| PubChem CID | 9083212 |
| Molecular Formula | C15H20N2O4S2 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.09 |
| IUPAC Name | (5R)-N'-[(3R)-1,1-dioxothiolane-3-carbonyl]-5-methyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carbohydrazide |
| SMILES | C[C@@H]1CCc2sc(C(=O)NNC(=O)[C@H]3CCS(=O)(=O)C3)cc2C1 |
| InChI | InChI=1S/C15H20N2O4S2/c1-9-2-3-12-11(6-9)7-13(22-12)15(19)17-16-14(18)10-4-5-23(20,21)8-10/h7,9-10H,2-6,8H2,1H3,(H,16,18)(H,17,19)/t9-,10+/m1/s1 |
| InChIKey | VRCCZDNRQXEUOS-ZJUUUORDSA-N |
| XLogP | 1.07 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|