C18H20N4O4 — CID 46429431
1-[3-[[(2-hydroxybenzoyl)amino]carbamoyl]phenyl]-3-propan-2-ylurea (PubChem CID 46429431) has the molecular formula C18H20N4O4 and a molecular weight of 356.38 g/mol. Its IUPAC name is 1-[3-[[(2-hydroxybenzoyl)amino]carbamoyl]phenyl]-3-propan-2-ylurea.
| Compound Name | 1-[3-[[(2-hydroxybenzoyl)amino]carbamoyl]phenyl]-3-propan-2-ylurea |
|---|---|
| PubChem CID | 46429431 |
| Molecular Formula | C18H20N4O4 |
| Molecular Weight | 356.38 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | 1-[3-[[(2-hydroxybenzoyl)amino]carbamoyl]phenyl]-3-propan-2-ylurea |
| SMILES | CC(C)NC(=O)Nc1cccc(C(=O)NNC(=O)c2ccccc2O)c1 |
| InChI | InChI=1S/C18H20N4O4/c1-11(2)19-18(26)20-13-7-5-6-12(10-13)16(24)21-22-17(25)14-8-3-4-9-15(14)23/h3-11,23H,1-2H3,(H,21,24)(H,22,25)(H2,19,20,26) |
| InChIKey | JXFYLKIEYQZGER-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 119.56 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.38 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|