C16H19N5O3 — CID 78868165
1-propan-2-yl-3-[3-[(1H-pyrrole-2-carbonylamino)carbamoyl]phenyl]urea (PubChem CID 78868165) has the molecular formula C16H19N5O3 and a molecular weight of 329.36 g/mol. Its IUPAC name is 1-propan-2-yl-3-[3-[(1H-pyrrole-2-carbonylamino)carbamoyl]phenyl]urea.
| Compound Name | 1-propan-2-yl-3-[3-[(1H-pyrrole-2-carbonylamino)carbamoyl]phenyl]urea |
|---|---|
| PubChem CID | 78868165 |
| Molecular Formula | C16H19N5O3 |
| Molecular Weight | 329.36 g/mol |
| Exact Mass | 329.15 |
| IUPAC Name | 1-propan-2-yl-3-[3-[(1H-pyrrole-2-carbonylamino)carbamoyl]phenyl]urea |
| SMILES | CC(C)NC(=O)Nc1cccc(C(=O)NNC(=O)c2ccc[nH]2)c1 |
| InChI | InChI=1S/C16H19N5O3/c1-10(2)18-16(24)19-12-6-3-5-11(9-12)14(22)20-21-15(23)13-7-4-8-17-13/h3-10,17H,1-2H3,(H,20,22)(H,21,23)(H2,18,19,24) |
| InChIKey | QQFVVPFPNGJOKH-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 115.12 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.36 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|