C21H26N2O4S — CID 9429006
(5S)-N'-[3-(2,3-dimethoxyphenyl)propanoyl]-5-methyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carbohydrazide (PubChem CID 9429006) has the molecular formula C21H26N2O4S and a molecular weight of 402.52 g/mol. Its IUPAC name is (5S)-N'-[3-(2,3-dimethoxyphenyl)propanoyl]-5-methyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carbohydrazide.
| Compound Name | (5S)-N'-[3-(2,3-dimethoxyphenyl)propanoyl]-5-methyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carbohydrazide |
|---|---|
| PubChem CID | 9429006 |
| Molecular Formula | C21H26N2O4S |
| Molecular Weight | 402.52 g/mol |
| Exact Mass | 402.16 |
| IUPAC Name | (5S)-N'-[3-(2,3-dimethoxyphenyl)propanoyl]-5-methyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carbohydrazide |
| SMILES | COc1cccc(CCC(=O)NNC(=O)c2cc3c(s2)CC[C@H](C)C3)c1OC |
| InChI | InChI=1S/C21H26N2O4S/c1-13-7-9-17-15(11-13)12-18(28-17)21(25)23-22-19(24)10-8-14-5-4-6-16(26-2)20(14)27-3/h4-6,12-13H,7-11H2,1-3H3,(H,22,24)(H,23,25)/t13-/m0/s1 |
| InChIKey | VRBSXFAOGBNYEO-ZDUSSCGKSA-N |
| XLogP | 3.28 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.52 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|