C22H29N3O5S2 — CID 46450567
N,N-diethyl-4-methoxy-3-[[(5-methyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carbonyl)amino]carbamoyl]benzenesulfonamide (PubChem CID 46450567) has the molecular formula C22H29N3O5S2 and a molecular weight of 479.62 g/mol. Its IUPAC name is N,N-diethyl-4-methoxy-3-[[(5-methyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carbonyl)amino]carbamoyl]benzenesulfonamide.
| Compound Name | N,N-diethyl-4-methoxy-3-[[(5-methyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carbonyl)amino]carbamoyl]benzenesulfonamide |
|---|---|
| PubChem CID | 46450567 |
| Molecular Formula | C22H29N3O5S2 |
| Molecular Weight | 479.62 g/mol |
| Exact Mass | 479.15 |
| IUPAC Name | N,N-diethyl-4-methoxy-3-[[(5-methyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carbonyl)amino]carbamoyl]benzenesulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(OC)c(C(=O)NNC(=O)c2cc3c(s2)CCC(C)C3)c1 |
| InChI | InChI=1S/C22H29N3O5S2/c1-5-25(6-2)32(28,29)16-8-9-18(30-4)17(13-16)21(26)23-24-22(27)20-12-15-11-14(3)7-10-19(15)31-20/h8-9,12-14H,5-7,10-11H2,1-4H3,(H,23,26)(H,24,27) |
| InChIKey | REHAZPJSUQRVDX-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.62 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|