C19H24N2O4S2 — CID 43050504
N-[2-[(4-methoxyphenyl)sulfonylamino]ethyl]-5-methyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxamide (PubChem CID 43050504) has the molecular formula C19H24N2O4S2 and a molecular weight of 408.55 g/mol. Its IUPAC name is N-[2-[(4-methoxyphenyl)sulfonylamino]ethyl]-5-methyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxamide.
| Compound Name | N-[2-[(4-methoxyphenyl)sulfonylamino]ethyl]-5-methyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 43050504 |
| Molecular Formula | C19H24N2O4S2 |
| Molecular Weight | 408.55 g/mol |
| Exact Mass | 408.12 |
| IUPAC Name | N-[2-[(4-methoxyphenyl)sulfonylamino]ethyl]-5-methyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carboxamide |
| SMILES | COc1ccc(S(=O)(=O)NCCNC(=O)c2cc3c(s2)CCC(C)C3)cc1 |
| InChI | InChI=1S/C19H24N2O4S2/c1-13-3-8-17-14(11-13)12-18(26-17)19(22)20-9-10-21-27(23,24)16-6-4-15(25-2)5-7-16/h4-7,12-13,21H,3,8-11H2,1-2H3,(H,20,22) |
| InChIKey | CTPGISNARWCQCW-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.55 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|