C20H25N3O5S2 — CID 55565015
N-(2-methoxyethyl)-3-[[(5-methyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carbonyl)amino]carbamoyl]benzenesulfonamide (PubChem CID 55565015) has the molecular formula C20H25N3O5S2 and a molecular weight of 451.57 g/mol. Its IUPAC name is N-(2-methoxyethyl)-3-[[(5-methyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carbonyl)amino]carbamoyl]benzenesulfonamide.
| Compound Name | N-(2-methoxyethyl)-3-[[(5-methyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carbonyl)amino]carbamoyl]benzenesulfonamide |
|---|---|
| PubChem CID | 55565015 |
| Molecular Formula | C20H25N3O5S2 |
| Molecular Weight | 451.57 g/mol |
| Exact Mass | 451.12 |
| IUPAC Name | N-(2-methoxyethyl)-3-[[(5-methyl-4,5,6,7-tetrahydro-1-benzothiophene-2-carbonyl)amino]carbamoyl]benzenesulfonamide |
| SMILES | COCCNS(=O)(=O)c1cccc(C(=O)NNC(=O)c2cc3c(s2)CCC(C)C3)c1 |
| InChI | InChI=1S/C20H25N3O5S2/c1-13-6-7-17-15(10-13)12-18(29-17)20(25)23-22-19(24)14-4-3-5-16(11-14)30(26,27)21-8-9-28-2/h3-5,11-13,21H,6-10H2,1-2H3,(H,22,24)(H,23,25) |
| InChIKey | UYFXVZMFCWIINQ-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.57 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|