C29H26N2O2 — CID 162426283
9-[(3-cyanophenyl)methyl]-7-(2-phenylethyl)-5,6,7,8-tetrahydrocarbazole-1-carboxylic acid (PubChem CID 162426283) has the molecular formula C29H26N2O2 and a molecular weight of 434.54 g/mol. Its IUPAC name is 9-[(3-cyanophenyl)methyl]-7-(2-phenylethyl)-5,6,7,8-tetrahydrocarbazole-1-carboxylic acid.
| Compound Name | 9-[(3-cyanophenyl)methyl]-7-(2-phenylethyl)-5,6,7,8-tetrahydrocarbazole-1-carboxylic acid |
|---|---|
| PubChem CID | 162426283 |
| Molecular Formula | C29H26N2O2 |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.20 |
| IUPAC Name | 9-[(3-cyanophenyl)methyl]-7-(2-phenylethyl)-5,6,7,8-tetrahydrocarbazole-1-carboxylic acid |
| SMILES | N#Cc1cccc(Cn2c3c(c4cccc(C(=O)O)c42)CCC(CCc2ccccc2)C3)c1 |
| InChI | InChI=1S/C29H26N2O2/c30-18-22-8-4-9-23(16-22)19-31-27-17-21(13-12-20-6-2-1-3-7-20)14-15-24(27)25-10-5-11-26(28(25)31)29(32)33/h1-11,16,21H,12-15,17,19H2,(H,32,33) |
| InChIKey | VTPVJHOQPJYMBA-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|