C24H30N4O — CID 22393346
1-(3-cyanophenyl)-3-[3-[3-(2-phenylethyl)piperidin-1-yl]propyl]urea (PubChem CID 22393346) has the molecular formula C24H30N4O and a molecular weight of 390.53 g/mol. Its IUPAC name is 1-(3-cyanophenyl)-3-[3-[3-(2-phenylethyl)piperidin-1-yl]propyl]urea.
| Compound Name | 1-(3-cyanophenyl)-3-[3-[3-(2-phenylethyl)piperidin-1-yl]propyl]urea |
|---|---|
| PubChem CID | 22393346 |
| Molecular Formula | C24H30N4O |
| Molecular Weight | 390.53 g/mol |
| Exact Mass | 390.24 |
| IUPAC Name | 1-(3-cyanophenyl)-3-[3-[3-(2-phenylethyl)piperidin-1-yl]propyl]urea |
| SMILES | N#Cc1cccc(NC(=O)NCCCN2CCCC(CCc3ccccc3)C2)c1 |
| InChI | InChI=1S/C24H30N4O/c25-18-22-9-4-11-23(17-22)27-24(29)26-14-6-16-28-15-5-10-21(19-28)13-12-20-7-2-1-3-8-20/h1-4,7-9,11,17,21H,5-6,10,12-16,19H2,(H2,26,27,29) |
| InChIKey | ATESZFLERLQBNT-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 68.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.53 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|