C27H41N3O — CID 22393376
1-(1-adamantyl)-3-[3-[3-(2-phenylethyl)piperidin-1-yl]propyl]urea (PubChem CID 22393376) has the molecular formula C27H41N3O and a molecular weight of 423.65 g/mol. Its IUPAC name is 1-(1-adamantyl)-3-[3-[3-(2-phenylethyl)piperidin-1-yl]propyl]urea.
| Compound Name | 1-(1-adamantyl)-3-[3-[3-(2-phenylethyl)piperidin-1-yl]propyl]urea |
|---|---|
| PubChem CID | 22393376 |
| Molecular Formula | C27H41N3O |
| Molecular Weight | 423.65 g/mol |
| Exact Mass | 423.32 |
| IUPAC Name | 1-(1-adamantyl)-3-[3-[3-(2-phenylethyl)piperidin-1-yl]propyl]urea |
| SMILES | O=C(NCCCN1CCCC(CCc2ccccc2)C1)NC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C27H41N3O/c31-26(29-27-17-23-14-24(18-27)16-25(15-23)19-27)28-11-5-13-30-12-4-8-22(20-30)10-9-21-6-2-1-3-7-21/h1-3,6-7,22-25H,4-5,8-20H2,(H2,28,29,31) |
| InChIKey | PCCQCOHIOVPLCW-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.65 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|