C22H28ClNO — CID 142125213
(2R)-2-(4-chlorophenyl)-1-[(3S)-3-(2-phenylethyl)piperidin-1-yl]propan-2-ol (PubChem CID 142125213) has the molecular formula C22H28ClNO and a molecular weight of 357.93 g/mol. Its IUPAC name is (2R)-2-(4-chlorophenyl)-1-[(3S)-3-(2-phenylethyl)piperidin-1-yl]propan-2-ol.
| Compound Name | (2R)-2-(4-chlorophenyl)-1-[(3S)-3-(2-phenylethyl)piperidin-1-yl]propan-2-ol |
|---|---|
| PubChem CID | 142125213 |
| Molecular Formula | C22H28ClNO |
| Molecular Weight | 357.93 g/mol |
| Exact Mass | 357.19 |
| IUPAC Name | (2R)-2-(4-chlorophenyl)-1-[(3S)-3-(2-phenylethyl)piperidin-1-yl]propan-2-ol |
| SMILES | C[C@](O)(CN1CCC[C@H](CCc2ccccc2)C1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H28ClNO/c1-22(25,20-11-13-21(23)14-12-20)17-24-15-5-8-19(16-24)10-9-18-6-3-2-4-7-18/h2-4,6-7,11-14,19,25H,5,8-10,15-17H2,1H3/t19-,22+/m1/s1 |
| InChIKey | WARBYHZYHYGSSK-KNQAVFIVSA-N |
| XLogP | 4.89 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.93 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |