C15H23ClN2 — CID 42254398
1-[(3R)-1-[2-(4-chlorophenyl)ethyl]piperidin-3-yl]-N-methylmethanamine (PubChem CID 42254398) has the molecular formula C15H23ClN2 and a molecular weight of 266.82 g/mol. Its IUPAC name is 1-[(3R)-1-[2-(4-chlorophenyl)ethyl]piperidin-3-yl]-N-methylmethanamine.
| Compound Name | 1-[(3R)-1-[2-(4-chlorophenyl)ethyl]piperidin-3-yl]-N-methylmethanamine |
|---|---|
| PubChem CID | 42254398 |
| Molecular Formula | C15H23ClN2 |
| Molecular Weight | 266.82 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | 1-[(3R)-1-[2-(4-chlorophenyl)ethyl]piperidin-3-yl]-N-methylmethanamine |
| SMILES | CNC[C@H]1CCCN(CCc2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C15H23ClN2/c1-17-11-14-3-2-9-18(12-14)10-8-13-4-6-15(16)7-5-13/h4-7,14,17H,2-3,8-12H2,1H3/t14-/m1/s1 |
| InChIKey | UBQXDXFPOHBPAE-CQSZACIVSA-N |
| XLogP | 2.81 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.82 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |