C14H21IN2 — CID 65479043
1-[1-[(4-iodophenyl)methyl]piperidin-3-yl]-N-methylmethanamine (PubChem CID 65479043) has the molecular formula C14H21IN2 and a molecular weight of 344.24 g/mol. Its IUPAC name is 1-[1-[(4-iodophenyl)methyl]piperidin-3-yl]-N-methylmethanamine.
| Compound Name | 1-[1-[(4-iodophenyl)methyl]piperidin-3-yl]-N-methylmethanamine |
|---|---|
| PubChem CID | 65479043 |
| Molecular Formula | C14H21IN2 |
| Molecular Weight | 344.24 g/mol |
| Exact Mass | 344.07 |
| IUPAC Name | 1-[1-[(4-iodophenyl)methyl]piperidin-3-yl]-N-methylmethanamine |
| SMILES | CNCC1CCCN(Cc2ccc(I)cc2)C1 |
| InChI | InChI=1S/C14H21IN2/c1-16-9-13-3-2-8-17(11-13)10-12-4-6-14(15)7-5-12/h4-7,13,16H,2-3,8-11H2,1H3 |
| InChIKey | DYACCYKOFXJAMS-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.24 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|