C14H20Cl3FN2 — CID 120835764
1-[1-[(2,3-dichloro-4-fluorophenyl)methyl]piperidin-3-yl]-N-methylmethanamine;hydrochloride (PubChem CID 120835764) has the molecular formula C14H20Cl3FN2 and a molecular weight of 341.69 g/mol. Its IUPAC name is 1-[1-[(2,3-dichloro-4-fluorophenyl)methyl]piperidin-3-yl]-N-methylmethanamine;hydrochloride.
| Compound Name | 1-[1-[(2,3-dichloro-4-fluorophenyl)methyl]piperidin-3-yl]-N-methylmethanamine;hydrochloride |
|---|---|
| PubChem CID | 120835764 |
| Molecular Formula | C14H20Cl3FN2 |
| Molecular Weight | 341.69 g/mol |
| Exact Mass | 340.07 |
| IUPAC Name | 1-[1-[(2,3-dichloro-4-fluorophenyl)methyl]piperidin-3-yl]-N-methylmethanamine;hydrochloride |
| SMILES | CNCC1CCCN(Cc2ccc(F)c(Cl)c2Cl)C1.Cl |
| InChI | InChI=1S/C14H19Cl2FN2.ClH/c1-18-7-10-3-2-6-19(8-10)9-11-4-5-12(17)14(16)13(11)15;/h4-5,10,18H,2-3,6-9H2,1H3;1H |
| InChIKey | JFGXMADHBZBVIU-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.69 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|