C15H22Cl3FN2 — CID 120843537
2-[1-[(2,3-dichloro-4-fluorophenyl)methyl]piperidin-4-yl]-N-methylethanamine;hydrochloride (PubChem CID 120843537) has the molecular formula C15H22Cl3FN2 and a molecular weight of 355.71 g/mol. Its IUPAC name is 2-[1-[(2,3-dichloro-4-fluorophenyl)methyl]piperidin-4-yl]-N-methylethanamine;hydrochloride.
| Compound Name | 2-[1-[(2,3-dichloro-4-fluorophenyl)methyl]piperidin-4-yl]-N-methylethanamine;hydrochloride |
|---|---|
| PubChem CID | 120843537 |
| Molecular Formula | C15H22Cl3FN2 |
| Molecular Weight | 355.71 g/mol |
| Exact Mass | 354.08 |
| IUPAC Name | 2-[1-[(2,3-dichloro-4-fluorophenyl)methyl]piperidin-4-yl]-N-methylethanamine;hydrochloride |
| SMILES | CNCCC1CCN(Cc2ccc(F)c(Cl)c2Cl)CC1.Cl |
| InChI | InChI=1S/C15H21Cl2FN2.ClH/c1-19-7-4-11-5-8-20(9-6-11)10-12-2-3-13(18)15(17)14(12)16;/h2-3,11,19H,4-10H2,1H3;1H |
| InChIKey | GHGDLEXEMAJSEO-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.71 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|