C17H28ClFN2O — CID 120843504
2-[1-[(4-ethoxy-3-fluorophenyl)methyl]piperidin-4-yl]-N-methylethanamine;hydrochloride (PubChem CID 120843504) has the molecular formula C17H28ClFN2O and a molecular weight of 330.88 g/mol. Its IUPAC name is 2-[1-[(4-ethoxy-3-fluorophenyl)methyl]piperidin-4-yl]-N-methylethanamine;hydrochloride.
| Compound Name | 2-[1-[(4-ethoxy-3-fluorophenyl)methyl]piperidin-4-yl]-N-methylethanamine;hydrochloride |
|---|---|
| PubChem CID | 120843504 |
| Molecular Formula | C17H28ClFN2O |
| Molecular Weight | 330.88 g/mol |
| Exact Mass | 330.19 |
| IUPAC Name | 2-[1-[(4-ethoxy-3-fluorophenyl)methyl]piperidin-4-yl]-N-methylethanamine;hydrochloride |
| SMILES | CCOc1ccc(CN2CCC(CCNC)CC2)cc1F.Cl |
| InChI | InChI=1S/C17H27FN2O.ClH/c1-3-21-17-5-4-15(12-16(17)18)13-20-10-7-14(8-11-20)6-9-19-2;/h4-5,12,14,19H,3,6-11,13H2,1-2H3;1H |
| InChIKey | DJSDDRGNRNMQPJ-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.88 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |