C12H16Cl3FN2 — CID 120845594
(3R)-1-[(2,3-dichloro-4-fluorophenyl)methyl]-3-methylpiperazine;hydrochloride (PubChem CID 120845594) has the molecular formula C12H16Cl3FN2 and a molecular weight of 313.63 g/mol. Its IUPAC name is (3R)-1-[(2,3-dichloro-4-fluorophenyl)methyl]-3-methylpiperazine;hydrochloride.
| Compound Name | (3R)-1-[(2,3-dichloro-4-fluorophenyl)methyl]-3-methylpiperazine;hydrochloride |
|---|---|
| PubChem CID | 120845594 |
| Molecular Formula | C12H16Cl3FN2 |
| Molecular Weight | 313.63 g/mol |
| Exact Mass | 312.04 |
| IUPAC Name | (3R)-1-[(2,3-dichloro-4-fluorophenyl)methyl]-3-methylpiperazine;hydrochloride |
| SMILES | C[C@@H]1CN(Cc2ccc(F)c(Cl)c2Cl)CCN1.Cl |
| InChI | InChI=1S/C12H15Cl2FN2.ClH/c1-8-6-17(5-4-16-8)7-9-2-3-10(15)12(14)11(9)13;/h2-3,8,16H,4-7H2,1H3;1H/t8-;/m1./s1 |
| InChIKey | ZEMOTDOXLYDMPQ-DDWIOCJRSA-N |
| XLogP | 3.35 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.63 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|