C14H22ClFN2 — CID 120845639
(3R)-1-[(2-ethyl-6-fluorophenyl)methyl]-3-methylpiperazine;hydrochloride (PubChem CID 120845639) has the molecular formula C14H22ClFN2 and a molecular weight of 272.79 g/mol. Its IUPAC name is (3R)-1-[(2-ethyl-6-fluorophenyl)methyl]-3-methylpiperazine;hydrochloride.
| Compound Name | (3R)-1-[(2-ethyl-6-fluorophenyl)methyl]-3-methylpiperazine;hydrochloride |
|---|---|
| PubChem CID | 120845639 |
| Molecular Formula | C14H22ClFN2 |
| Molecular Weight | 272.79 g/mol |
| Exact Mass | 272.15 |
| IUPAC Name | (3R)-1-[(2-ethyl-6-fluorophenyl)methyl]-3-methylpiperazine;hydrochloride |
| SMILES | CCc1cccc(F)c1CN1CCN[C@H](C)C1.Cl |
| InChI | InChI=1S/C14H21FN2.ClH/c1-3-12-5-4-6-14(15)13(12)10-17-8-7-16-11(2)9-17;/h4-6,11,16H,3,7-10H2,1-2H3;1H/t11-;/m1./s1 |
| InChIKey | KRHCPMRELXOSBD-RFVHGSKJSA-N |
| XLogP | 2.60 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.79 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |