C12H16ClFN2 — CID 96916148
(3R)-1-[(5-chloro-2-fluorophenyl)methyl]-3-methylpiperazine (PubChem CID 96916148) has the molecular formula C12H16ClFN2 and a molecular weight of 242.72 g/mol. Its IUPAC name is (3R)-1-[(5-chloro-2-fluorophenyl)methyl]-3-methylpiperazine.
| Compound Name | (3R)-1-[(5-chloro-2-fluorophenyl)methyl]-3-methylpiperazine |
|---|---|
| PubChem CID | 96916148 |
| Molecular Formula | C12H16ClFN2 |
| Molecular Weight | 242.72 g/mol |
| Exact Mass | 242.10 |
| IUPAC Name | (3R)-1-[(5-chloro-2-fluorophenyl)methyl]-3-methylpiperazine |
| SMILES | C[C@@H]1CN(Cc2cc(Cl)ccc2F)CCN1 |
| InChI | InChI=1S/C12H16ClFN2/c1-9-7-16(5-4-15-9)8-10-6-11(13)2-3-12(10)14/h2-3,6,9,15H,4-5,7-8H2,1H3/t9-/m1/s1 |
| InChIKey | QDOSOUVDKPTWBV-SECBINFHSA-N |
| XLogP | 2.27 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.72 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |