About 1-[(5-chloro-2-fluorophenyl)methyl]-2,5-dimethylpiperazine;hydrochloride
1-[(5-chloro-2-fluorophenyl)methyl]-2,5-dimethylpiperazine;hydrochloride (PubChem CID 120906190) has the molecular formula C13H19Cl2FN2
and a molecular weight of 293.21 g/mol. Its IUPAC name is 1-[(5-chloro-2-fluorophenyl)methyl]-2,5-dimethylpiperazine;hydrochloride.
Molecular Properties
| Compound Name | 1-[(5-chloro-2-fluorophenyl)methyl]-2,5-dimethylpiperazine;hydrochloride |
| PubChem CID | 120906190 |
| Molecular Formula | C13H19Cl2FN2 |
| Molecular Weight | 293.21 g/mol |
| Exact Mass | 292.09 |
| IUPAC Name | 1-[(5-chloro-2-fluorophenyl)methyl]-2,5-dimethylpiperazine;hydrochloride |
| SMILES | CC1CN(Cc2cc(Cl)ccc2F)C(C)CN1.Cl |
| InChI | InChI=1S/C13H18ClFN2.ClH/c1-9-7-17(10(2)6-16-9)8-11-5-12(14)3-4-13(11)15;/h3-5,9-10,16H,6-8H2,1-2H3;1H |
| InChIKey | UYXNEGVZAGDYDH-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.21 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[(5-chloro-2-fluorophenyl)methyl]-2,5-dimethylpiperazine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(5-chloro-2-fluorophenyl)methyl]-2,5-dimethylpiperazine;hydrochloride?
The IUPAC name of 1-[(5-chloro-2-fluorophenyl)methyl]-2,5-dimethylpiperazine;hydrochloride (CID 120906190) is 1-[(5-chloro-2-fluorophenyl)methyl]-2,5-dimethylpiperazine;hydrochloride.
What is the SMILES notation for 1-[(5-chloro-2-fluorophenyl)methyl]-2,5-dimethylpiperazine;hydrochloride?
The canonical SMILES for 1-[(5-chloro-2-fluorophenyl)methyl]-2,5-dimethylpiperazine;hydrochloride is CC1CN(Cc2cc(Cl)ccc2F)C(C)CN1.Cl.
What is the InChIKey of 1-[(5-chloro-2-fluorophenyl)methyl]-2,5-dimethylpiperazine;hydrochloride?
The InChIKey is UYXNEGVZAGDYDH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18ClFN2.ClH/c1-9-7-17(10(2)6-16-9)8-11-5-12(14)3-4-13(11)15;/h3-5,9-10,16H,6-8H2,1-2H3;1H.
What are the key properties of 1-[(5-chloro-2-fluorophenyl)methyl]-2,5-dimethylpiperazine;hydrochloride?
1-[(5-chloro-2-fluorophenyl)methyl]-2,5-dimethylpiperazine;hydrochloride has a molecular weight of 293.21 g/mol, XLogP of 3.08, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(5-chloro-2-fluorophenyl)methyl]-2,5-dimethylpiperazine;hydrochloride is sourced from PubChem (CID 120906190), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).