C12H16ClN3O2 — CID 104975926
(3R)-1-[(4-chloro-2-nitrophenyl)methyl]-3-methylpiperazine (PubChem CID 104975926) has the molecular formula C12H16ClN3O2 and a molecular weight of 269.73 g/mol. Its IUPAC name is (3R)-1-[(4-chloro-2-nitrophenyl)methyl]-3-methylpiperazine.
| Compound Name | (3R)-1-[(4-chloro-2-nitrophenyl)methyl]-3-methylpiperazine |
|---|---|
| PubChem CID | 104975926 |
| Molecular Formula | C12H16ClN3O2 |
| Molecular Weight | 269.73 g/mol |
| Exact Mass | 269.09 |
| IUPAC Name | (3R)-1-[(4-chloro-2-nitrophenyl)methyl]-3-methylpiperazine |
| SMILES | C[C@@H]1CN(Cc2ccc(Cl)cc2[N+](=O)[O-])CCN1 |
| InChI | InChI=1S/C12H16ClN3O2/c1-9-7-15(5-4-14-9)8-10-2-3-11(13)6-12(10)16(17)18/h2-3,6,9,14H,4-5,7-8H2,1H3/t9-/m1/s1 |
| InChIKey | ILQTYYPSSSIZSU-SECBINFHSA-N |
| XLogP | 2.04 |
| TPSA | 58.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.73 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|