C22H28ClNOS — CID 164906162
1-[2-(3-chlorophenyl)ethyl]-3-[2-(4-methylsulfinylphenyl)ethyl]piperidine (PubChem CID 164906162) has the molecular formula C22H28ClNOS and a molecular weight of 389.99 g/mol. Its IUPAC name is 1-[2-(3-chlorophenyl)ethyl]-3-[2-(4-methylsulfinylphenyl)ethyl]piperidine.
| Compound Name | 1-[2-(3-chlorophenyl)ethyl]-3-[2-(4-methylsulfinylphenyl)ethyl]piperidine |
|---|---|
| PubChem CID | 164906162 |
| Molecular Formula | C22H28ClNOS |
| Molecular Weight | 389.99 g/mol |
| Exact Mass | 389.16 |
| IUPAC Name | 1-[2-(3-chlorophenyl)ethyl]-3-[2-(4-methylsulfinylphenyl)ethyl]piperidine |
| SMILES | CS(=O)c1ccc(CCC2CCCN(CCc3cccc(Cl)c3)C2)cc1 |
| InChI | InChI=1S/C22H28ClNOS/c1-26(25)22-11-9-18(10-12-22)7-8-20-5-3-14-24(17-20)15-13-19-4-2-6-21(23)16-19/h2,4,6,9-12,16,20H,3,5,7-8,13-15,17H2,1H3 |
| InChIKey | SANUCIQJXOCIAI-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.99 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |