C21H26ClNO3S — CID 164906333
1-[2-(3-chlorophenyl)ethyl]-3-[(4-methylsulfinylphenoxy)methyl]piperidin-4-ol (PubChem CID 164906333) has the molecular formula C21H26ClNO3S and a molecular weight of 407.96 g/mol. Its IUPAC name is 1-[2-(3-chlorophenyl)ethyl]-3-[(4-methylsulfinylphenoxy)methyl]piperidin-4-ol.
| Compound Name | 1-[2-(3-chlorophenyl)ethyl]-3-[(4-methylsulfinylphenoxy)methyl]piperidin-4-ol |
|---|---|
| PubChem CID | 164906333 |
| Molecular Formula | C21H26ClNO3S |
| Molecular Weight | 407.96 g/mol |
| Exact Mass | 407.13 |
| IUPAC Name | 1-[2-(3-chlorophenyl)ethyl]-3-[(4-methylsulfinylphenoxy)methyl]piperidin-4-ol |
| SMILES | CS(=O)c1ccc(OCC2CN(CCc3cccc(Cl)c3)CCC2O)cc1 |
| InChI | InChI=1S/C21H26ClNO3S/c1-27(25)20-7-5-19(6-8-20)26-15-17-14-23(12-10-21(17)24)11-9-16-3-2-4-18(22)13-16/h2-8,13,17,21,24H,9-12,14-15H2,1H3 |
| InChIKey | DMOGCUXKDHWTGZ-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.96 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |