C22H28ClNO4S — CID 175502440
(3R)-1-[2-(3-chlorophenyl)ethyl]-4-methoxy-3-[(4-methylsulfonylphenoxy)methyl]piperidine (PubChem CID 175502440) has the molecular formula C22H28ClNO4S and a molecular weight of 437.99 g/mol. Its IUPAC name is (3R)-1-[2-(3-chlorophenyl)ethyl]-4-methoxy-3-[(4-methylsulfonylphenoxy)methyl]piperidine.
| Compound Name | (3R)-1-[2-(3-chlorophenyl)ethyl]-4-methoxy-3-[(4-methylsulfonylphenoxy)methyl]piperidine |
|---|---|
| PubChem CID | 175502440 |
| Molecular Formula | C22H28ClNO4S |
| Molecular Weight | 437.99 g/mol |
| Exact Mass | 437.14 |
| IUPAC Name | (3R)-1-[2-(3-chlorophenyl)ethyl]-4-methoxy-3-[(4-methylsulfonylphenoxy)methyl]piperidine |
| SMILES | COC1CCN(CCc2cccc(Cl)c2)C[C@@H]1COc1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C22H28ClNO4S/c1-27-22-11-13-24(12-10-17-4-3-5-19(23)14-17)15-18(22)16-28-20-6-8-21(9-7-20)29(2,25)26/h3-9,14,18,22H,10-13,15-16H2,1-2H3/t18-,22?/m1/s1 |
| InChIKey | YNTLXVHRWJUXCS-ZZWBGTBQSA-N |
| XLogP | 3.70 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.99 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |