C27H30ClNO3S — CID 142782102
1-[(3-chlorophenyl)methyl]-4-[2-[4-(4-methylsulfonylphenyl)phenoxy]ethyl]piperidine (PubChem CID 142782102) has the molecular formula C27H30ClNO3S and a molecular weight of 484.06 g/mol. Its IUPAC name is 1-[(3-chlorophenyl)methyl]-4-[2-[4-(4-methylsulfonylphenyl)phenoxy]ethyl]piperidine.
| Compound Name | 1-[(3-chlorophenyl)methyl]-4-[2-[4-(4-methylsulfonylphenyl)phenoxy]ethyl]piperidine |
|---|---|
| PubChem CID | 142782102 |
| Molecular Formula | C27H30ClNO3S |
| Molecular Weight | 484.06 g/mol |
| Exact Mass | 483.16 |
| IUPAC Name | 1-[(3-chlorophenyl)methyl]-4-[2-[4-(4-methylsulfonylphenyl)phenoxy]ethyl]piperidine |
| SMILES | CS(=O)(=O)c1ccc(-c2ccc(OCCC3CCN(Cc4cccc(Cl)c4)CC3)cc2)cc1 |
| InChI | InChI=1S/C27H30ClNO3S/c1-33(30,31)27-11-7-24(8-12-27)23-5-9-26(10-6-23)32-18-15-21-13-16-29(17-14-21)20-22-3-2-4-25(28)19-22/h2-12,19,21H,13-18,20H2,1H3 |
| InChIKey | WLLIBJDIEZYODP-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.06 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |