C25H29NO7 — CID 67812960
4-[2-(1-benzylpiperidin-4-yl)ethoxy]benzoic acid;but-2-enedioic acid (PubChem CID 67812960) has the molecular formula C25H29NO7 and a molecular weight of 455.51 g/mol. Its IUPAC name is 4-[2-(1-benzylpiperidin-4-yl)ethoxy]benzoic acid;but-2-enedioic acid.
| Compound Name | 4-[2-(1-benzylpiperidin-4-yl)ethoxy]benzoic acid;but-2-enedioic acid |
|---|---|
| PubChem CID | 67812960 |
| Molecular Formula | C25H29NO7 |
| Molecular Weight | 455.51 g/mol |
| Exact Mass | 455.19 |
| IUPAC Name | 4-[2-(1-benzylpiperidin-4-yl)ethoxy]benzoic acid;but-2-enedioic acid |
| SMILES | O=C(O)C=CC(=O)O.O=C(O)c1ccc(OCCC2CCN(Cc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C21H25NO3.C4H4O4/c23-21(24)19-6-8-20(9-7-19)25-15-12-17-10-13-22(14-11-17)16-18-4-2-1-3-5-18;5-3(6)1-2-4(7)8/h1-9,17H,10-16H2,(H,23,24);1-2H,(H,5,6)(H,7,8) |
| InChIKey | KDERMQLYMWQVET-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 124.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.51 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|