C30H36N2O6 — CID 19108443
1-(1-acetyl-3,4-dihydro-2H-quinolin-6-yl)-3-(1-benzylpiperidin-4-yl)propan-1-one;(E)-but-2-enedioic acid (PubChem CID 19108443) has the molecular formula C30H36N2O6 and a molecular weight of 520.63 g/mol. Its IUPAC name is 1-(1-acetyl-3,4-dihydro-2H-quinolin-6-yl)-3-(1-benzylpiperidin-4-yl)propan-1-one;(E)-but-2-enedioic acid.
| Compound Name | 1-(1-acetyl-3,4-dihydro-2H-quinolin-6-yl)-3-(1-benzylpiperidin-4-yl)propan-1-one;(E)-but-2-enedioic acid |
|---|---|
| PubChem CID | 19108443 |
| Molecular Formula | C30H36N2O6 |
| Molecular Weight | 520.63 g/mol |
| Exact Mass | 520.26 |
| IUPAC Name | 1-(1-acetyl-3,4-dihydro-2H-quinolin-6-yl)-3-(1-benzylpiperidin-4-yl)propan-1-one;(E)-but-2-enedioic acid |
| SMILES | CC(=O)N1CCCc2cc(C(=O)CCC3CCN(Cc4ccccc4)CC3)ccc21.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C26H32N2O2.C4H4O4/c1-20(29)28-15-5-8-23-18-24(10-11-25(23)28)26(30)12-9-21-13-16-27(17-14-21)19-22-6-3-2-4-7-22;5-3(6)1-2-4(7)8/h2-4,6-7,10-11,18,21H,5,8-9,12-17,19H2,1H3;1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | MAWARJJOUDZFDZ-WLHGVMLRSA-N |
| XLogP | 4.57 |
| TPSA | 115.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.63 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|