C22H28ClN3O3S — CID 164906304
(3S)-3-[[4-(azetidin-3-ylsulfonyl)phenoxy]methyl]-1-[2-(3-chlorophenyl)ethyl]piperazine (PubChem CID 164906304) has the molecular formula C22H28ClN3O3S and a molecular weight of 450.00 g/mol. Its IUPAC name is (3S)-3-[[4-(azetidin-3-ylsulfonyl)phenoxy]methyl]-1-[2-(3-chlorophenyl)ethyl]piperazine.
| Compound Name | (3S)-3-[[4-(azetidin-3-ylsulfonyl)phenoxy]methyl]-1-[2-(3-chlorophenyl)ethyl]piperazine |
|---|---|
| PubChem CID | 164906304 |
| Molecular Formula | C22H28ClN3O3S |
| Molecular Weight | 450.00 g/mol |
| Exact Mass | 449.15 |
| IUPAC Name | (3S)-3-[[4-(azetidin-3-ylsulfonyl)phenoxy]methyl]-1-[2-(3-chlorophenyl)ethyl]piperazine |
| SMILES | O=S(=O)(c1ccc(OC[C@@H]2CN(CCc3cccc(Cl)c3)CCN2)cc1)C1CNC1 |
| InChI | InChI=1S/C22H28ClN3O3S/c23-18-3-1-2-17(12-18)8-10-26-11-9-25-19(15-26)16-29-20-4-6-21(7-5-20)30(27,28)22-13-24-14-22/h1-7,12,19,22,24-25H,8-11,13-16H2/t19-/m0/s1 |
| InChIKey | KWJMAMPSNVJBBM-IBGZPJMESA-N |
| XLogP | 1.98 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.00 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |