C21H33N3O4S — CID 172620293
1-[3-[4-[[4-(3-methylbutyl)piperazin-2-yl]methoxy]phenyl]sulfonylazetidin-1-yl]ethanone (PubChem CID 172620293) has the molecular formula C21H33N3O4S and a molecular weight of 423.58 g/mol. Its IUPAC name is 1-[3-[4-[[4-(3-methylbutyl)piperazin-2-yl]methoxy]phenyl]sulfonylazetidin-1-yl]ethanone.
| Compound Name | 1-[3-[4-[[4-(3-methylbutyl)piperazin-2-yl]methoxy]phenyl]sulfonylazetidin-1-yl]ethanone |
|---|---|
| PubChem CID | 172620293 |
| Molecular Formula | C21H33N3O4S |
| Molecular Weight | 423.58 g/mol |
| Exact Mass | 423.22 |
| IUPAC Name | 1-[3-[4-[[4-(3-methylbutyl)piperazin-2-yl]methoxy]phenyl]sulfonylazetidin-1-yl]ethanone |
| SMILES | CC(=O)N1CC(S(=O)(=O)c2ccc(OCC3CN(CCC(C)C)CCN3)cc2)C1 |
| InChI | InChI=1S/C21H33N3O4S/c1-16(2)8-10-23-11-9-22-18(12-23)15-28-19-4-6-20(7-5-19)29(26,27)21-13-24(14-21)17(3)25/h4-7,16,18,21-22H,8-15H2,1-3H3 |
| InChIKey | QDQPZTTVUXJUKC-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.58 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |