C19H33N3O2S — CID 172620532
3-[[4-(azetidin-3-ylsulfinyl)phenoxy]methyl]-1-propylpiperazine;ethane (PubChem CID 172620532) has the molecular formula C19H33N3O2S and a molecular weight of 367.56 g/mol. Its IUPAC name is 3-[[4-(azetidin-3-ylsulfinyl)phenoxy]methyl]-1-propylpiperazine;ethane.
| Compound Name | 3-[[4-(azetidin-3-ylsulfinyl)phenoxy]methyl]-1-propylpiperazine;ethane |
|---|---|
| PubChem CID | 172620532 |
| Molecular Formula | C19H33N3O2S |
| Molecular Weight | 367.56 g/mol |
| Exact Mass | 367.23 |
| IUPAC Name | 3-[[4-(azetidin-3-ylsulfinyl)phenoxy]methyl]-1-propylpiperazine;ethane |
| SMILES | CC.CCCN1CCNC(COc2ccc(S(=O)C3CNC3)cc2)C1 |
| InChI | InChI=1S/C17H27N3O2S.C2H6/c1-2-8-20-9-7-19-14(12-20)13-22-15-3-5-16(6-4-15)23(21)17-10-18-11-17;1-2/h3-6,14,17-19H,2,7-13H2,1H3;1-2H3 |
| InChIKey | XPSQAKCZLDONJJ-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.56 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |