C22H23F6N — CID 167080885
3-[2-[4-(trifluoromethyl)phenyl]ethyl]-1-[[4-(trifluoromethyl)phenyl]methyl]piperidine (PubChem CID 167080885) has the molecular formula C22H23F6N and a molecular weight of 415.42 g/mol. Its IUPAC name is 3-[2-[4-(trifluoromethyl)phenyl]ethyl]-1-[[4-(trifluoromethyl)phenyl]methyl]piperidine.
| Compound Name | 3-[2-[4-(trifluoromethyl)phenyl]ethyl]-1-[[4-(trifluoromethyl)phenyl]methyl]piperidine |
|---|---|
| PubChem CID | 167080885 |
| Molecular Formula | C22H23F6N |
| Molecular Weight | 415.42 g/mol |
| Exact Mass | 415.17 |
| IUPAC Name | 3-[2-[4-(trifluoromethyl)phenyl]ethyl]-1-[[4-(trifluoromethyl)phenyl]methyl]piperidine |
| SMILES | FC(F)(F)c1ccc(CCC2CCCN(Cc3ccc(C(F)(F)F)cc3)C2)cc1 |
| InChI | InChI=1S/C22H23F6N/c23-21(24,25)19-9-5-16(6-10-19)3-4-17-2-1-13-29(14-17)15-18-7-11-20(12-8-18)22(26,27)28/h5-12,17H,1-4,13-15H2 |
| InChIKey | ZRZCFJWZPNUQDD-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.42 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |