C19H19ClF3N — CID 167080813
3-(4-chlorophenyl)-1-[[4-(trifluoromethyl)phenyl]methyl]piperidine (PubChem CID 167080813) has the molecular formula C19H19ClF3N and a molecular weight of 353.82 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-1-[[4-(trifluoromethyl)phenyl]methyl]piperidine.
| Compound Name | 3-(4-chlorophenyl)-1-[[4-(trifluoromethyl)phenyl]methyl]piperidine |
|---|---|
| PubChem CID | 167080813 |
| Molecular Formula | C19H19ClF3N |
| Molecular Weight | 353.82 g/mol |
| Exact Mass | 353.12 |
| IUPAC Name | 3-(4-chlorophenyl)-1-[[4-(trifluoromethyl)phenyl]methyl]piperidine |
| SMILES | FC(F)(F)c1ccc(CN2CCCC(c3ccc(Cl)cc3)C2)cc1 |
| InChI | InChI=1S/C19H19ClF3N/c20-18-9-5-15(6-10-18)16-2-1-11-24(13-16)12-14-3-7-17(8-4-14)19(21,22)23/h3-10,16H,1-2,11-13H2 |
| InChIKey | RPOSAJFTTRLYAC-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.82 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |