C20H21ClF3N — CID 167080866
1-[[2-chloro-4-(trifluoromethyl)phenyl]methyl]-3-(4-methylphenyl)piperidine (PubChem CID 167080866) has the molecular formula C20H21ClF3N and a molecular weight of 367.84 g/mol. Its IUPAC name is 1-[[2-chloro-4-(trifluoromethyl)phenyl]methyl]-3-(4-methylphenyl)piperidine.
| Compound Name | 1-[[2-chloro-4-(trifluoromethyl)phenyl]methyl]-3-(4-methylphenyl)piperidine |
|---|---|
| PubChem CID | 167080866 |
| Molecular Formula | C20H21ClF3N |
| Molecular Weight | 367.84 g/mol |
| Exact Mass | 367.13 |
| IUPAC Name | 1-[[2-chloro-4-(trifluoromethyl)phenyl]methyl]-3-(4-methylphenyl)piperidine |
| SMILES | Cc1ccc(C2CCCN(Cc3ccc(C(F)(F)F)cc3Cl)C2)cc1 |
| InChI | InChI=1S/C20H21ClF3N/c1-14-4-6-15(7-5-14)16-3-2-10-25(12-16)13-17-8-9-18(11-19(17)21)20(22,23)24/h4-9,11,16H,2-3,10,12-13H2,1H3 |
| InChIKey | VPUASZRWAJPSOA-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.84 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |